C13H19NO4 — CID 140960691
2-(2-hydroxyethoxy)ethyl N-(3,5-dimethylphenyl)carbamate (PubChem CID 140960691) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl N-(3,5-dimethylphenyl)carbamate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl N-(3,5-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 140960691 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl N-(3,5-dimethylphenyl)carbamate |
| SMILES | Cc1cc(C)cc(NC(=O)OCCOCCO)c1 |
| InChI | InChI=1S/C13H19NO4/c1-10-7-11(2)9-12(8-10)14-13(16)18-6-5-17-4-3-15/h7-9,15H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | GWUBQSONAQOPOM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|