C38H60O6 — CID 54265100
6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethylperoxy]hexyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate (PubChem CID 54265100) has the molecular formula C38H60O6 and a molecular weight of 612.89 g/mol. Its IUPAC name is 6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethylperoxy]hexyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate.
| Compound Name | 6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethylperoxy]hexyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 54265100 |
| Molecular Formula | C38H60O6 |
| Molecular Weight | 612.89 g/mol |
| Exact Mass | 612.44 |
| IUPAC Name | 6-[2-(3,5-ditert-butyl-4-hydroxyphenyl)ethylperoxy]hexyl 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
| SMILES | CC(C)(C)c1cc(CCOOCCCCCCOC(=O)Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C38H60O6/c1-35(2,3)28-21-26(22-29(33(28)40)36(4,5)6)17-20-44-43-19-16-14-13-15-18-42-32(39)25-27-23-30(37(7,8)9)34(41)31(24-27)38(10,11)12/h21-24,40-41H,13-20,25H2,1-12H3 |
| InChIKey | RGEZLDDFZXASHK-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.89 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|