C27H38O3 — CID 14765967
[2,4-bis(2-methylbutan-2-yl)phenyl] 3-tert-butyl-4-hydroxybenzoate (PubChem CID 14765967) has the molecular formula C27H38O3 and a molecular weight of 410.60 g/mol. Its IUPAC name is [2,4-bis(2-methylbutan-2-yl)phenyl] 3-tert-butyl-4-hydroxybenzoate.
| Compound Name | [2,4-bis(2-methylbutan-2-yl)phenyl] 3-tert-butyl-4-hydroxybenzoate |
|---|---|
| PubChem CID | 14765967 |
| Molecular Formula | C27H38O3 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.28 |
| IUPAC Name | [2,4-bis(2-methylbutan-2-yl)phenyl] 3-tert-butyl-4-hydroxybenzoate |
| SMILES | CCC(C)(C)c1ccc(OC(=O)c2ccc(O)c(C(C)(C)C)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C27H38O3/c1-10-26(6,7)19-13-15-23(21(17-19)27(8,9)11-2)30-24(29)18-12-14-22(28)20(16-18)25(3,4)5/h12-17,28H,10-11H2,1-9H3 |
| InChIKey | RGKJDLAIODNTAP-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|