C23H30O5 — CID 177108131
(2,4-ditert-butylphenyl) 4-hydroxy-3,5-dimethoxybenzoate (PubChem CID 177108131) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) 4-hydroxy-3,5-dimethoxybenzoate.
| Compound Name | (2,4-ditert-butylphenyl) 4-hydroxy-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 177108131 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2,4-ditert-butylphenyl) 4-hydroxy-3,5-dimethoxybenzoate |
| SMILES | COc1cc(C(=O)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)cc(OC)c1O |
| InChI | InChI=1S/C23H30O5/c1-22(2,3)15-9-10-17(16(13-15)23(4,5)6)28-21(25)14-11-18(26-7)20(24)19(12-14)27-8/h9-13,24H,1-8H3 |
| InChIKey | DUMYDVKQURJFNZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|