C18H26O2 — CID 173361101
1-(3-tert-butyl-4-hydroxyphenyl)-5,5-dimethylhex-1-en-3-one (PubChem CID 173361101) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is 1-(3-tert-butyl-4-hydroxyphenyl)-5,5-dimethylhex-1-en-3-one.
| Compound Name | 1-(3-tert-butyl-4-hydroxyphenyl)-5,5-dimethylhex-1-en-3-one |
|---|---|
| PubChem CID | 173361101 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | 1-(3-tert-butyl-4-hydroxyphenyl)-5,5-dimethylhex-1-en-3-one |
| SMILES | CC(C)(C)CC(=O)C=Cc1ccc(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H26O2/c1-17(2,3)12-14(19)9-7-13-8-10-16(20)15(11-13)18(4,5)6/h7-11,20H,12H2,1-6H3 |
| InChIKey | WVMFTZWDLPHKRS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|