C20H22O5 — CID 57064960
5-[5-(3-tert-butyl-4-hydroxyphenyl)-3-oxopent-4-enyl]furan-2-carboxylic acid (PubChem CID 57064960) has the molecular formula C20H22O5 and a molecular weight of 342.39 g/mol. Its IUPAC name is 5-[5-(3-tert-butyl-4-hydroxyphenyl)-3-oxopent-4-enyl]furan-2-carboxylic acid.
| Compound Name | 5-[5-(3-tert-butyl-4-hydroxyphenyl)-3-oxopent-4-enyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 57064960 |
| Molecular Formula | C20H22O5 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 5-[5-(3-tert-butyl-4-hydroxyphenyl)-3-oxopent-4-enyl]furan-2-carboxylic acid |
| SMILES | CC(C)(C)c1cc(C=CC(=O)CCc2ccc(C(=O)O)o2)ccc1O |
| InChI | InChI=1S/C20H22O5/c1-20(2,3)16-12-13(5-10-17(16)22)4-6-14(21)7-8-15-9-11-18(25-15)19(23)24/h4-6,9-12,22H,7-8H2,1-3H3,(H,23,24) |
| InChIKey | ZPBDQBJXMVZBGN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|