C32H46O8 — CID 11584884
diethyl (2R,3R)-2,3-bis[(3-tert-butyl-4-hydroxy-5-methoxyphenyl)methyl]butanedioate (PubChem CID 11584884) has the molecular formula C32H46O8 and a molecular weight of 558.71 g/mol. Its IUPAC name is diethyl (2R,3R)-2,3-bis[(3-tert-butyl-4-hydroxy-5-methoxyphenyl)methyl]butanedioate.
| Compound Name | diethyl (2R,3R)-2,3-bis[(3-tert-butyl-4-hydroxy-5-methoxyphenyl)methyl]butanedioate |
|---|---|
| PubChem CID | 11584884 |
| Molecular Formula | C32H46O8 |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | diethyl (2R,3R)-2,3-bis[(3-tert-butyl-4-hydroxy-5-methoxyphenyl)methyl]butanedioate |
| SMILES | CCOC(=O)[C@H](Cc1cc(OC)c(O)c(C(C)(C)C)c1)[C@@H](Cc1cc(OC)c(O)c(C(C)(C)C)c1)C(=O)OCC |
| InChI | InChI=1S/C32H46O8/c1-11-39-29(35)21(13-19-15-23(31(3,4)5)27(33)25(17-19)37-9)22(30(36)40-12-2)14-20-16-24(32(6,7)8)28(34)26(18-20)38-10/h15-18,21-22,33-34H,11-14H2,1-10H3/t21-,22-/m1/s1 |
| InChIKey | HGRIZDHGWQQXNQ-FGZHOGPDSA-N |
| XLogP | 5.85 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |