C14H20O5 — CID 140767261
3-ethoxy-4-(4-hydroxy-3,5-dimethoxyphenyl)butan-2-one (PubChem CID 140767261) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3-ethoxy-4-(4-hydroxy-3,5-dimethoxyphenyl)butan-2-one.
| Compound Name | 3-ethoxy-4-(4-hydroxy-3,5-dimethoxyphenyl)butan-2-one |
|---|---|
| PubChem CID | 140767261 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 3-ethoxy-4-(4-hydroxy-3,5-dimethoxyphenyl)butan-2-one |
| SMILES | CCOC(Cc1cc(OC)c(O)c(OC)c1)C(C)=O |
| InChI | InChI=1S/C14H20O5/c1-5-19-11(9(2)15)6-10-7-12(17-3)14(16)13(8-10)18-4/h7-8,11,16H,5-6H2,1-4H3 |
| InChIKey | RBAJKUDBWPTHKN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |