About propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate
propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate (PubChem CID 11025971) has the molecular formula C14H18Br2O4
and a molecular weight of 410.10 g/mol. Its IUPAC name is propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate.
Molecular Properties
| Compound Name | propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate |
| PubChem CID | 11025971 |
| Molecular Formula | C14H18Br2O4 |
| Molecular Weight | 410.10 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate |
| SMILES | CCO[C@@H](Cc1cc(Br)c(O)c(Br)c1)C(=O)OC(C)C |
| InChI | InChI=1S/C14H18Br2O4/c1-4-19-12(14(18)20-8(2)3)7-9-5-10(15)13(17)11(16)6-9/h5-6,8,12,17H,4,7H2,1-3H3/t12-/m0/s1 |
| InChIKey | VMPWOEOXXNXWDC-LBPRGKRZSA-N |
| XLogP | 3.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.10 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate?
The IUPAC name of propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate (CID 11025971) is propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate.
What is the SMILES notation for propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate?
The canonical SMILES for propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate is CCO[C@@H](Cc1cc(Br)c(O)c(Br)c1)C(=O)OC(C)C.
What is the InChIKey of propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate?
The InChIKey is VMPWOEOXXNXWDC-LBPRGKRZSA-N. The full InChI is InChI=1S/C14H18Br2O4/c1-4-19-12(14(18)20-8(2)3)7-9-5-10(15)13(17)11(16)6-9/h5-6,8,12,17H,4,7H2,1-3H3/t12-/m0/s1.
What are the key properties of propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate?
propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate has a molecular weight of 410.10 g/mol, XLogP of 3.82, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (2S)-3-(3,5-dibromo-4-hydroxyphenyl)-2-ethoxypropanoate is sourced from PubChem (CID 11025971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).