C14H20O4 — CID 68679680
propan-2-yl 2-ethoxy-3-(4-hydroxyphenyl)propanoate (PubChem CID 68679680) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is propan-2-yl 2-ethoxy-3-(4-hydroxyphenyl)propanoate.
| Compound Name | propan-2-yl 2-ethoxy-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 68679680 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | propan-2-yl 2-ethoxy-3-(4-hydroxyphenyl)propanoate |
| SMILES | CCOC(Cc1ccc(O)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C14H20O4/c1-4-17-13(14(16)18-10(2)3)9-11-5-7-12(15)8-6-11/h5-8,10,13,15H,4,9H2,1-3H3 |
| InChIKey | XRWDRCMXDCLIOS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |