C21H26O4 — CID 86587076
ethyl (2R)-3-(4-hydroxyphenyl)-2-(4-phenylbutoxy)propanoate (PubChem CID 86587076) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethyl (2R)-3-(4-hydroxyphenyl)-2-(4-phenylbutoxy)propanoate.
| Compound Name | ethyl (2R)-3-(4-hydroxyphenyl)-2-(4-phenylbutoxy)propanoate |
|---|---|
| PubChem CID | 86587076 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | ethyl (2R)-3-(4-hydroxyphenyl)-2-(4-phenylbutoxy)propanoate |
| SMILES | CCOC(=O)[C@@H](Cc1ccc(O)cc1)OCCCCc1ccccc1 |
| InChI | InChI=1S/C21H26O4/c1-2-24-21(23)20(16-18-11-13-19(22)14-12-18)25-15-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,11-14,20,22H,2,6-7,10,15-16H2,1H3/t20-/m1/s1 |
| InChIKey | ZIDZSBYFKVRISD-HXUWFJFHSA-N |
| XLogP | 3.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|