C19H21O4- — CID 22557570
3-(4-hydroxyphenyl)-2-(4-phenylbutoxy)propanoate (PubChem CID 22557570) has the molecular formula C19H21O4- and a molecular weight of 313.37 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-(4-phenylbutoxy)propanoate.
| Compound Name | 3-(4-hydroxyphenyl)-2-(4-phenylbutoxy)propanoate |
|---|---|
| PubChem CID | 22557570 |
| Molecular Formula | C19H21O4- |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-(4-phenylbutoxy)propanoate |
| SMILES | O=C([O-])C(Cc1ccc(O)cc1)OCCCCc1ccccc1 |
| InChI | InChI=1S/C19H22O4/c20-17-11-9-16(10-12-17)14-18(19(21)22)23-13-5-4-8-15-6-2-1-3-7-15/h1-3,6-7,9-12,18,20H,4-5,8,13-14H2,(H,21,22)/p-1 |
| InChIKey | CYVSYKWHFLECEU-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|