C33H30O4 — CID 175330596
2-[5-(4-benzoylphenyl)pentoxy]-1,3-diphenylpropane-1,3-dione (PubChem CID 175330596) has the molecular formula C33H30O4 and a molecular weight of 490.60 g/mol. Its IUPAC name is 2-[5-(4-benzoylphenyl)pentoxy]-1,3-diphenylpropane-1,3-dione.
| Compound Name | 2-[5-(4-benzoylphenyl)pentoxy]-1,3-diphenylpropane-1,3-dione |
|---|---|
| PubChem CID | 175330596 |
| Molecular Formula | C33H30O4 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | 2-[5-(4-benzoylphenyl)pentoxy]-1,3-diphenylpropane-1,3-dione |
| SMILES | O=C(c1ccccc1)c1ccc(CCCCCOC(C(=O)c2ccccc2)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C33H30O4/c34-30(26-14-6-1-7-15-26)29-22-20-25(21-23-29)13-5-4-12-24-37-33(31(35)27-16-8-2-9-17-27)32(36)28-18-10-3-11-19-28/h1-3,6-11,14-23,33H,4-5,12-13,24H2 |
| InChIKey | ZUYPOMRHLVDOAQ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|