C47H44O6 — CID 153324958
[4-[[5-[(4-benzoylphenyl)methoxy-phenylmethoxy]pentoxy-phenylmethoxy]methyl]phenyl]-phenylmethanone (PubChem CID 153324958) has the molecular formula C47H44O6 and a molecular weight of 704.86 g/mol. Its IUPAC name is [4-[[5-[(4-benzoylphenyl)methoxy-phenylmethoxy]pentoxy-phenylmethoxy]methyl]phenyl]-phenylmethanone.
| Compound Name | [4-[[5-[(4-benzoylphenyl)methoxy-phenylmethoxy]pentoxy-phenylmethoxy]methyl]phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 153324958 |
| Molecular Formula | C47H44O6 |
| Molecular Weight | 704.86 g/mol |
| Exact Mass | 704.31 |
| IUPAC Name | [4-[[5-[(4-benzoylphenyl)methoxy-phenylmethoxy]pentoxy-phenylmethoxy]methyl]phenyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)c1ccc(COC(OCCCCCOC(OCc2ccc(C(=O)c3ccccc3)cc2)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H44O6/c48-44(38-16-6-1-7-17-38)40-28-24-36(25-29-40)34-52-46(42-20-10-3-11-21-42)50-32-14-5-15-33-51-47(43-22-12-4-13-23-43)53-35-37-26-30-41(31-27-37)45(49)39-18-8-2-9-19-39/h1-4,6-13,16-31,46-47H,5,14-15,32-35H2 |
| InChIKey | AGJSUFCSNDBAPZ-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.86 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|