C28H32O3 — CID 57009230
[4-[hydroxy(phenyl)methyl]phenyl]-(4-octoxyphenyl)methanone (PubChem CID 57009230) has the molecular formula C28H32O3 and a molecular weight of 416.56 g/mol. Its IUPAC name is [4-[hydroxy(phenyl)methyl]phenyl]-(4-octoxyphenyl)methanone.
| Compound Name | [4-[hydroxy(phenyl)methyl]phenyl]-(4-octoxyphenyl)methanone |
|---|---|
| PubChem CID | 57009230 |
| Molecular Formula | C28H32O3 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [4-[hydroxy(phenyl)methyl]phenyl]-(4-octoxyphenyl)methanone |
| SMILES | CCCCCCCCOc1ccc(C(=O)c2ccc(C(O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H32O3/c1-2-3-4-5-6-10-21-31-26-19-17-25(18-20-26)28(30)24-15-13-23(14-16-24)27(29)22-11-8-7-9-12-22/h7-9,11-20,27,29H,2-6,10,21H2,1H3 |
| InChIKey | FPOVSPZXTIGOIH-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|