C18H19NO6 — CID 163240313
(2R)-2-[2-(4-hydroxyphenyl)ethoxycarbonylamino]oxy-3-phenylpropanoic acid (PubChem CID 163240313) has the molecular formula C18H19NO6 and a molecular weight of 345.35 g/mol. Its IUPAC name is (2R)-2-[2-(4-hydroxyphenyl)ethoxycarbonylamino]oxy-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[2-(4-hydroxyphenyl)ethoxycarbonylamino]oxy-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 163240313 |
| Molecular Formula | C18H19NO6 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | (2R)-2-[2-(4-hydroxyphenyl)ethoxycarbonylamino]oxy-3-phenylpropanoic acid |
| SMILES | O=C(NO[C@H](Cc1ccccc1)C(=O)O)OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C18H19NO6/c20-15-8-6-13(7-9-15)10-11-24-18(23)19-25-16(17(21)22)12-14-4-2-1-3-5-14/h1-9,16,20H,10-12H2,(H,19,23)(H,21,22)/t16-/m1/s1 |
| InChIKey | BMHSMAPTLPKBQG-MRXNPFEDSA-N |
| XLogP | 2.29 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|