C26H40O8 — CID 139655831
triethyl 1-hydroxy-2-(9-phenylnonoxy)ethane-1,1,2-tricarboxylate (PubChem CID 139655831) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is triethyl 1-hydroxy-2-(9-phenylnonoxy)ethane-1,1,2-tricarboxylate.
| Compound Name | triethyl 1-hydroxy-2-(9-phenylnonoxy)ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 139655831 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | triethyl 1-hydroxy-2-(9-phenylnonoxy)ethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(OCCCCCCCCCc1ccccc1)C(O)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C26H40O8/c1-4-31-23(27)22(26(30,24(28)32-5-2)25(29)33-6-3)34-20-16-11-9-7-8-10-13-17-21-18-14-12-15-19-21/h12,14-15,18-19,22,30H,4-11,13,16-17,20H2,1-3H3 |
| InChIKey | BJXDITFFXSPLER-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|