C27H34O10 — CID 139655757
triethyl 1-hydroxy-2-[4-(4-phenoxyphenoxy)butoxy]ethane-1,1,2-tricarboxylate (PubChem CID 139655757) has the molecular formula C27H34O10 and a molecular weight of 518.56 g/mol. Its IUPAC name is triethyl 1-hydroxy-2-[4-(4-phenoxyphenoxy)butoxy]ethane-1,1,2-tricarboxylate.
| Compound Name | triethyl 1-hydroxy-2-[4-(4-phenoxyphenoxy)butoxy]ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 139655757 |
| Molecular Formula | C27H34O10 |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | triethyl 1-hydroxy-2-[4-(4-phenoxyphenoxy)butoxy]ethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(OCCCCOc1ccc(Oc2ccccc2)cc1)C(O)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C27H34O10/c1-4-32-24(28)23(27(31,25(29)33-5-2)26(30)34-6-3)36-19-11-10-18-35-20-14-16-22(17-15-20)37-21-12-8-7-9-13-21/h7-9,12-17,23,31H,4-6,10-11,18-19H2,1-3H3 |
| InChIKey | SYIAUCLEXCYFBC-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 126.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|