C25H38O9 — CID 139655703
triethyl 1-hydroxy-2-[4-(4-phenylbutoxy)butoxy]ethane-1,1,2-tricarboxylate (PubChem CID 139655703) has the molecular formula C25H38O9 and a molecular weight of 482.57 g/mol. Its IUPAC name is triethyl 1-hydroxy-2-[4-(4-phenylbutoxy)butoxy]ethane-1,1,2-tricarboxylate.
| Compound Name | triethyl 1-hydroxy-2-[4-(4-phenylbutoxy)butoxy]ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 139655703 |
| Molecular Formula | C25H38O9 |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.25 |
| IUPAC Name | triethyl 1-hydroxy-2-[4-(4-phenylbutoxy)butoxy]ethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(OCCCCOCCCCc1ccccc1)C(O)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H38O9/c1-4-31-22(26)21(25(29,23(27)32-5-2)24(28)33-6-3)34-19-13-12-18-30-17-11-10-16-20-14-8-7-9-15-20/h7-9,14-15,21,29H,4-6,10-13,16-19H2,1-3H3 |
| InChIKey | OOKPAWNAHUUOIV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|