C25H42O3 — CID 174248124
hexyl 4-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methylbutanoate (PubChem CID 174248124) has the molecular formula C25H42O3 and a molecular weight of 390.61 g/mol. Its IUPAC name is hexyl 4-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methylbutanoate.
| Compound Name | hexyl 4-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 174248124 |
| Molecular Formula | C25H42O3 |
| Molecular Weight | 390.61 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | hexyl 4-(3,5-ditert-butyl-4-hydroxyphenyl)-3-methylbutanoate |
| SMILES | CCCCCCOC(=O)CC(C)Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C25H42O3/c1-9-10-11-12-13-28-22(26)15-18(2)14-19-16-20(24(3,4)5)23(27)21(17-19)25(6,7)8/h16-18,27H,9-15H2,1-8H3 |
| InChIKey | QTUBSGHPIYTIQK-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|