C36H62O5 — CID 141134272
dioctyl 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentanedioate (PubChem CID 141134272) has the molecular formula C36H62O5 and a molecular weight of 574.89 g/mol. Its IUPAC name is dioctyl 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentanedioate.
| Compound Name | dioctyl 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentanedioate |
|---|---|
| PubChem CID | 141134272 |
| Molecular Formula | C36H62O5 |
| Molecular Weight | 574.89 g/mol |
| Exact Mass | 574.46 |
| IUPAC Name | dioctyl 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]pentanedioate |
| SMILES | CCCCCCCCOC(=O)CCC(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)OCCCCCCCC |
| InChI | InChI=1S/C36H62O5/c1-9-11-13-15-17-19-23-40-32(37)22-21-29(34(39)41-24-20-18-16-14-12-10-2)25-28-26-30(35(3,4)5)33(38)31(27-28)36(6,7)8/h26-27,29,38H,9-25H2,1-8H3 |
| InChIKey | BTKVQYCAUCVKDK-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.89 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|