C32H53NO5 — CID 155011051
3-[1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentan-2-yl]oxy-3-oxopropanoic acid (PubChem CID 155011051) has the molecular formula C32H53NO5 and a molecular weight of 531.78 g/mol. Its IUPAC name is 3-[1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentan-2-yl]oxy-3-oxopropanoic acid.
| Compound Name | 3-[1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentan-2-yl]oxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 155011051 |
| Molecular Formula | C32H53NO5 |
| Molecular Weight | 531.78 g/mol |
| Exact Mass | 531.39 |
| IUPAC Name | 3-[1-(3,5-ditert-butyl-4-hydroxyphenyl)-2-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentan-2-yl]oxy-3-oxopropanoic acid |
| SMILES | CCCC(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)(OC(=O)CC(=O)O)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C32H53NO5/c1-13-14-32(38-26(36)17-25(34)35,22-19-30(8,9)33(12)31(10,11)20-22)18-21-15-23(28(2,3)4)27(37)24(16-21)29(5,6)7/h15-16,22,37H,13-14,17-20H2,1-12H3,(H,34,35) |
| InChIKey | DSOJJTNMVWRQPY-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.78 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|