C41H68N2O5 — CID 91448406
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-cyclopropyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate (PubChem CID 91448406) has the molecular formula C41H68N2O5 and a molecular weight of 669.00 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-cyclopropyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-cyclopropyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 91448406 |
| Molecular Formula | C41H68N2O5 |
| Molecular Weight | 669.00 g/mol |
| Exact Mass | 668.51 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-cyclopropyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)C(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)(C(=O)OC2CC(C)(C)N(C)C(C)(C)C2)C2CC2)CC1(C)C |
| InChI | InChI=1S/C41H68N2O5/c1-35(2,3)30-19-26(20-31(32(30)44)36(4,5)6)21-41(27-17-18-27,33(45)47-28-22-37(7,8)42(15)38(9,10)23-28)34(46)48-29-24-39(11,12)43(16)40(13,14)25-29/h19-20,27-29,44H,17-18,21-25H2,1-16H3 |
| InChIKey | JLIQIETVVZXQJV-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.00 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|