C39H70N2O — CID 90741452
2,6-ditert-butyl-4-[2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]propyl]phenol (PubChem CID 90741452) has the molecular formula C39H70N2O and a molecular weight of 583.00 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]propyl]phenol.
| Compound Name | 2,6-ditert-butyl-4-[2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]propyl]phenol |
|---|---|
| PubChem CID | 90741452 |
| Molecular Formula | C39H70N2O |
| Molecular Weight | 583.00 g/mol |
| Exact Mass | 582.55 |
| IUPAC Name | 2,6-ditert-butyl-4-[2-methyl-3-(1,2,2,6,6-pentamethylpiperidin-4-yl)-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]propyl]phenol |
| SMILES | CN1C(C)(C)CC(CC(C)(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C39H70N2O/c1-33(2,3)30-18-27(19-31(32(30)42)34(4,5)6)24-39(15,25-28-20-35(7,8)40(16)36(9,10)21-28)26-29-22-37(11,12)41(17)38(13,14)23-29/h18-19,28-29,42H,20-26H2,1-17H3 |
| InChIKey | NYCZEGJDDWXEAI-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.00 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |