C40H69N — CID 134370008
4-[[4-[[4-[(3,5-ditert-butyl-4-methylphenyl)methyl]cyclohexyl]methyl]cyclohexyl]methyl]-1,2,2,6,6-pentamethylpiperidine (PubChem CID 134370008) has the molecular formula C40H69N and a molecular weight of 564.00 g/mol. Its IUPAC name is 4-[[4-[[4-[(3,5-ditert-butyl-4-methylphenyl)methyl]cyclohexyl]methyl]cyclohexyl]methyl]-1,2,2,6,6-pentamethylpiperidine.
| Compound Name | 4-[[4-[[4-[(3,5-ditert-butyl-4-methylphenyl)methyl]cyclohexyl]methyl]cyclohexyl]methyl]-1,2,2,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 134370008 |
| Molecular Formula | C40H69N |
| Molecular Weight | 564.00 g/mol |
| Exact Mass | 563.54 |
| IUPAC Name | 4-[[4-[[4-[(3,5-ditert-butyl-4-methylphenyl)methyl]cyclohexyl]methyl]cyclohexyl]methyl]-1,2,2,6,6-pentamethylpiperidine |
| SMILES | Cc1c(C(C)(C)C)cc(CC2CCC(CC3CCC(CC4CC(C)(C)N(C)C(C)(C)C4)CC3)CC2)cc1C(C)(C)C |
| InChI | InChI=1S/C40H69N/c1-28-35(37(2,3)4)24-33(25-36(28)38(5,6)7)22-31-17-13-29(14-18-31)21-30-15-19-32(20-16-30)23-34-26-39(8,9)41(12)40(10,11)27-34/h24-25,29-32,34H,13-23,26-27H2,1-12H3 |
| InChIKey | MOADKDQQAHKELC-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.00 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |