C29H45Y- — CID 59931202
1,3-dimethyl-5-[[4-[[4-(4-methylcyclohexyl)cyclohexyl]methyl]cyclohexyl]methyl]benzene-2-ide;yttrium (PubChem CID 59931202) has the molecular formula C29H45Y- and a molecular weight of 482.59 g/mol. Its IUPAC name is 1,3-dimethyl-5-[[4-[[4-(4-methylcyclohexyl)cyclohexyl]methyl]cyclohexyl]methyl]benzene-2-ide;yttrium.
| Compound Name | 1,3-dimethyl-5-[[4-[[4-(4-methylcyclohexyl)cyclohexyl]methyl]cyclohexyl]methyl]benzene-2-ide;yttrium |
|---|---|
| PubChem CID | 59931202 |
| Molecular Formula | C29H45Y- |
| Molecular Weight | 482.59 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | 1,3-dimethyl-5-[[4-[[4-(4-methylcyclohexyl)cyclohexyl]methyl]cyclohexyl]methyl]benzene-2-ide;yttrium |
| SMILES | Cc1[c-]c(C)cc(CC2CCC(CC3CCC(C4CCC(C)CC4)CC3)CC2)c1.[Y] |
| InChI | InChI=1S/C29H45.Y/c1-21-4-12-28(13-5-21)29-14-10-26(11-15-29)19-24-6-8-25(9-7-24)20-27-17-22(2)16-23(3)18-27;/h17-18,21,24-26,28-29H,4-15,19-20H2,1-3H3;/q-1; |
| InChIKey | BHGWERYUUOWAKK-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.59 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|