C23H52 — CID 143714212
ethane;1-methyl-4-[(4-methylcyclohexyl)methyl]cyclohexane (PubChem CID 143714212) has the molecular formula C23H52 and a molecular weight of 328.67 g/mol. Its IUPAC name is ethane;1-methyl-4-[(4-methylcyclohexyl)methyl]cyclohexane.
| Compound Name | ethane;1-methyl-4-[(4-methylcyclohexyl)methyl]cyclohexane |
|---|---|
| PubChem CID | 143714212 |
| Molecular Formula | C23H52 |
| Molecular Weight | 328.67 g/mol |
| Exact Mass | 328.41 |
| IUPAC Name | ethane;1-methyl-4-[(4-methylcyclohexyl)methyl]cyclohexane |
| SMILES | CC.CC.CC.CC.CC1CCC(CC2CCC(C)CC2)CC1 |
| InChI | InChI=1S/C15H28.4C2H6/c1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15;4*1-2/h12-15H,3-11H2,1-2H3;4*1-2H3 |
| InChIKey | DRTKRVFJZWVXGH-UHFFFAOYSA-N |
| XLogP | 9.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.67 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |