About 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane
1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane (PubChem CID 142912938) has the molecular formula C25H52
and a molecular weight of 352.69 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane.
Molecular Properties
| Compound Name | 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane |
| PubChem CID | 142912938 |
| Molecular Formula | C25H52 |
| Molecular Weight | 352.69 g/mol |
| Exact Mass | 352.41 |
| IUPAC Name | 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane |
| SMILES | CC.CC.CC1CCC(CC2CCCCC2)CC1.CC1CCCCC1 |
| InChI | InChI=1S/C14H26.C7H14.2C2H6/c1-12-7-9-14(10-8-12)11-13-5-3-2-4-6-13;1-7-5-3-2-4-6-7;2*1-2/h12-14H,2-11H2,1H3;7H,2-6H2,1H3;2*1-2H3 |
| InChIKey | WXVQATIAXXNLSK-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.69 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane?
The IUPAC name of 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane (CID 142912938) is 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane.
What is the SMILES notation for 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane?
The canonical SMILES for 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane is CC.CC.CC1CCC(CC2CCCCC2)CC1.CC1CCCCC1.
What is the InChIKey of 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane?
The InChIKey is WXVQATIAXXNLSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26.C7H14.2C2H6/c1-12-7-9-14(10-8-12)11-13-5-3-2-4-6-13;1-7-5-3-2-4-6-7;2*1-2/h12-14H,2-11H2,1H3;7H,2-6H2,1H3;2*1-2H3.
What are the key properties of 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane?
1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane has a molecular weight of 352.69 g/mol, XLogP of 9.42, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclohexylmethyl)-4-methylcyclohexane;ethane;methylcyclohexane is sourced from PubChem (CID 142912938), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).