C43H74N2O5 — CID 176897785
bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]butanedioate (PubChem CID 176897785) has the molecular formula C43H74N2O5 and a molecular weight of 699.07 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]butanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]butanedioate |
|---|---|
| PubChem CID | 176897785 |
| Molecular Formula | C43H74N2O5 |
| Molecular Weight | 699.07 g/mol |
| Exact Mass | 698.56 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-butyl-2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]butanedioate |
| SMILES | CCCCC(CC(=O)OC1CC(C)(C)N(C)C(C)(C)C1)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C43H74N2O5/c1-18-19-20-43(36(48)50-31-26-41(12,13)45(17)42(14,15)27-31,28-34(46)49-30-24-39(8,9)44(16)40(10,11)25-30)23-29-21-32(37(2,3)4)35(47)33(22-29)38(5,6)7/h21-22,30-31,47H,18-20,23-28H2,1-17H3 |
| InChIKey | YOAYGNFRFANIFL-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.07 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |