C61H100N4O8 — CID 21324544
bis[1-(diethylcarbamoyl)-2,2,6,6-tetramethylpiperidin-4-yl] 2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate (PubChem CID 21324544) has the molecular formula C61H100N4O8 and a molecular weight of 1017.49 g/mol. Its IUPAC name is bis[1-(diethylcarbamoyl)-2,2,6,6-tetramethylpiperidin-4-yl] 2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | bis[1-(diethylcarbamoyl)-2,2,6,6-tetramethylpiperidin-4-yl] 2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 21324544 |
| Molecular Formula | C61H100N4O8 |
| Molecular Weight | 1017.49 g/mol |
| Exact Mass | 1016.75 |
| IUPAC Name | bis[1-(diethylcarbamoyl)-2,2,6,6-tetramethylpiperidin-4-yl] 2,2-bis[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CCN(CC)C(=O)N1C(C)(C)CC(OC(=O)C(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=O)OC2CC(C)(C)N(C(=O)N(CC)CC)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C61H100N4O8/c1-25-62(26-2)51(70)64-57(17,18)35-41(36-58(64,19)20)72-49(68)61(33-39-29-43(53(5,6)7)47(66)44(30-39)54(8,9)10,34-40-31-45(55(11,12)13)48(67)46(32-40)56(14,15)16)50(69)73-42-37-59(21,22)65(60(23,24)38-42)52(71)63(27-3)28-4/h29-32,41-42,66-67H,25-28,33-38H2,1-24H3 |
| InChIKey | SZDIKEUFVOSOGU-UHFFFAOYSA-N |
| XLogP | 13.11 |
| TPSA | 140.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.49 |
| LogP ≤ 5 | 13.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|