C47H74N2O6 — CID 23342538
bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]propanedioate (PubChem CID 23342538) has the molecular formula C47H74N2O6 and a molecular weight of 763.12 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]propanedioate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 23342538 |
| Molecular Formula | C47H74N2O6 |
| Molecular Weight | 763.12 g/mol |
| Exact Mass | 762.55 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 2,2-bis[(4-tert-butyl-3-hydroxy-2,6-dimethylphenyl)methyl]propanedioate |
| SMILES | Cc1cc(C(C)(C)C)c(O)c(C)c1CC(Cc1c(C)cc(C(C)(C)C)c(O)c1C)(C(=O)OC1CC(C)(C)NC(C)(C)C1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C47H74N2O6/c1-27-19-35(41(5,6)7)37(50)29(3)33(27)25-47(39(52)54-31-21-43(11,12)48-44(13,14)22-31,40(53)55-32-23-45(15,16)49-46(17,18)24-32)26-34-28(2)20-36(42(8,9)10)38(51)30(34)4/h19-20,31-32,48-51H,21-26H2,1-18H3 |
| InChIKey | HWUHPAFORPMXLH-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.12 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|