C47H81N3O7 — CID 89244874
1-O-[4-methyl-4-(propan-2-ylamino)pentan-2-yl] 1-O,2-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]ethane-1,1,2-tricarboxylate (PubChem CID 89244874) has the molecular formula C47H81N3O7 and a molecular weight of 800.18 g/mol. Its IUPAC name is 1-O-[4-methyl-4-(propan-2-ylamino)pentan-2-yl] 1-O,2-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]ethane-1,1,2-tricarboxylate.
| Compound Name | 1-O-[4-methyl-4-(propan-2-ylamino)pentan-2-yl] 1-O,2-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 89244874 |
| Molecular Formula | C47H81N3O7 |
| Molecular Weight | 800.18 g/mol |
| Exact Mass | 799.61 |
| IUPAC Name | 1-O-[4-methyl-4-(propan-2-ylamino)pentan-2-yl] 1-O,2-O-bis(2,2,6,6-tetramethylpiperidin-4-yl) 1-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]ethane-1,1,2-tricarboxylate |
| SMILES | CC(C)NC(C)(C)CC(C)OC(=O)C(CC(=O)OC1CC(C)(C)NC(C)(C)C1)(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C47H81N3O7/c1-29(2)48-42(10,11)22-30(3)55-38(53)47(39(54)57-33-26-45(16,17)50-46(18,19)27-33,28-36(51)56-32-24-43(12,13)49-44(14,15)25-32)23-31-20-34(40(4,5)6)37(52)35(21-31)41(7,8)9/h20-21,29-30,32-33,48-50,52H,22-28H2,1-19H3 |
| InChIKey | PZUOUOWRNDOCPG-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.18 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|