C31H53NO3 — CID 143162480
(1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2,3-trimethylbutanoate (PubChem CID 143162480) has the molecular formula C31H53NO3 and a molecular weight of 487.77 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2,3-trimethylbutanoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2,3-trimethylbutanoate |
|---|---|
| PubChem CID | 143162480 |
| Molecular Formula | C31H53NO3 |
| Molecular Weight | 487.77 g/mol |
| Exact Mass | 487.40 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 4-(3,5-ditert-butyl-4-hydroxyphenyl)-2,2,3-trimethylbutanoate |
| SMILES | CC(Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(C)(C)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C31H53NO3/c1-20(15-21-16-23(27(2,3)4)25(33)24(17-21)28(5,6)7)31(12,13)26(34)35-22-18-29(8,9)32(14)30(10,11)19-22/h16-17,20,22,33H,15,18-19H2,1-14H3 |
| InChIKey | YQSDUXBQYKSWDO-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.77 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |