C38H64N2O5 — CID 141077542
bis(1,2,2,6,6-pentamethylpiperidin-3-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate (PubChem CID 141077542) has the molecular formula C38H64N2O5 and a molecular weight of 628.94 g/mol. Its IUPAC name is bis(1,2,2,6,6-pentamethylpiperidin-3-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate.
| Compound Name | bis(1,2,2,6,6-pentamethylpiperidin-3-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 141077542 |
| Molecular Formula | C38H64N2O5 |
| Molecular Weight | 628.94 g/mol |
| Exact Mass | 628.48 |
| IUPAC Name | bis(1,2,2,6,6-pentamethylpiperidin-3-yl) 2-[(3,5-ditert-butyl-4-hydroxyphenyl)methyl]propanedioate |
| SMILES | CN1C(C)(C)CCC(OC(=O)C(Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C(=O)OC2CCC(C)(C)N(C)C2(C)C)C1(C)C |
| InChI | InChI=1S/C38H64N2O5/c1-33(2,3)26-22-24(23-27(30(26)41)34(4,5)6)21-25(31(42)44-28-17-19-35(7,8)39(15)37(28,11)12)32(43)45-29-18-20-36(9,10)40(16)38(29,13)14/h22-23,25,28-29,41H,17-21H2,1-16H3 |
| InChIKey | JMIXNHKVQLDOHM-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.94 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|