C42H72N2O5 — CID 87403894
1-O-[5-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl] 3-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanedioate (PubChem CID 87403894) has the molecular formula C42H72N2O5 and a molecular weight of 685.05 g/mol. Its IUPAC name is 1-O-[5-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl] 3-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanedioate.
| Compound Name | 1-O-[5-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl] 3-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanedioate |
|---|---|
| PubChem CID | 87403894 |
| Molecular Formula | C42H72N2O5 |
| Molecular Weight | 685.05 g/mol |
| Exact Mass | 684.54 |
| IUPAC Name | 1-O-[5-(3,5-ditert-butyl-4-hydroxyphenyl)pentyl] 3-O-(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-(1,2,2,6,6-pentamethylpiperidin-4-yl)propanedioate |
| SMILES | CN1C(C)(C)CC(OC(=O)C(C(=O)OCCCCCc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)C2CC(C)(C)N(C)C(C)(C)C2)CC1(C)C |
| InChI | InChI=1S/C42H72N2O5/c1-37(2,3)31-22-28(23-32(34(31)45)38(4,5)6)20-18-17-19-21-48-35(46)33(29-24-39(7,8)43(15)40(9,10)25-29)36(47)49-30-26-41(11,12)44(16)42(13,14)27-30/h22-23,29-30,33,45H,17-21,24-27H2,1-16H3 |
| InChIKey | ASTWTLSGKZWLPF-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.05 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|