C32H55NO3 — CID 175064164
[5-(3,5-ditert-butyl-4-hydroxyphenyl)-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentyl] propanoate (PubChem CID 175064164) has the molecular formula C32H55NO3 and a molecular weight of 501.80 g/mol. Its IUPAC name is [5-(3,5-ditert-butyl-4-hydroxyphenyl)-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentyl] propanoate.
| Compound Name | [5-(3,5-ditert-butyl-4-hydroxyphenyl)-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentyl] propanoate |
|---|---|
| PubChem CID | 175064164 |
| Molecular Formula | C32H55NO3 |
| Molecular Weight | 501.80 g/mol |
| Exact Mass | 501.42 |
| IUPAC Name | [5-(3,5-ditert-butyl-4-hydroxyphenyl)-5-(1,2,2,6,6-pentamethylpiperidin-4-yl)pentyl] propanoate |
| SMILES | CCC(=O)OCCCCC(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C32H55NO3/c1-13-27(34)36-17-15-14-16-24(23-20-31(8,9)33(12)32(10,11)21-23)22-18-25(29(2,3)4)28(35)26(19-22)30(5,6)7/h18-19,23-24,35H,13-17,20-21H2,1-12H3 |
| InChIKey | AAUOJTLDRHOBMH-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.80 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|