C42H72N2O5 — CID 87839503
3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)pentan-2-yl]oxy-3-oxopropanoic acid (PubChem CID 87839503) has the molecular formula C42H72N2O5 and a molecular weight of 685.05 g/mol. Its IUPAC name is 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)pentan-2-yl]oxy-3-oxopropanoic acid.
| Compound Name | 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)pentan-2-yl]oxy-3-oxopropanoic acid |
|---|---|
| PubChem CID | 87839503 |
| Molecular Formula | C42H72N2O5 |
| Molecular Weight | 685.05 g/mol |
| Exact Mass | 684.54 |
| IUPAC Name | 3-[2-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)pentan-2-yl]oxy-3-oxopropanoic acid |
| SMILES | CCC(C1CC(C)(C)N(C)C(C)(C)C1)(C1CC(C)(C)N(C)C(C)(C)C1)C(C)(OC(=O)CC(=O)O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H72N2O5/c1-19-42(28-23-37(8,9)43(17)38(10,11)24-28,29-25-39(12,13)44(18)40(14,15)26-29)41(16,49-33(47)22-32(45)46)27-20-30(35(2,3)4)34(48)31(21-27)36(5,6)7/h20-21,28-29,48H,19,22-26H2,1-18H3,(H,45,46) |
| InChIKey | BHBQAYRFDQJOGK-UHFFFAOYSA-N |
| XLogP | 9.41 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.05 |
| LogP ≤ 5 | 9.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|