C39H68N2O5 — CID 175008644
3-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-bis[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]propanoic acid (PubChem CID 175008644) has the molecular formula C39H68N2O5 and a molecular weight of 644.98 g/mol. Its IUPAC name is 3-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-bis[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]propanoic acid.
| Compound Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-bis[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 175008644 |
| Molecular Formula | C39H68N2O5 |
| Molecular Weight | 644.98 g/mol |
| Exact Mass | 644.51 |
| IUPAC Name | 3-(3,5-ditert-butyl-4-hydroxyphenyl)-3,3-bis[1-(2-hydroxyethyl)-2,2,6,6-tetramethylpiperidin-4-yl]propanoic acid |
| SMILES | CC(C)(C)c1cc(C(CC(=O)O)(C2CC(C)(C)N(CCO)C(C)(C)C2)C2CC(C)(C)N(CCO)C(C)(C)C2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C39H68N2O5/c1-33(2,3)29-19-26(20-30(32(29)46)34(4,5)6)39(25-31(44)45,27-21-35(7,8)40(15-17-42)36(9,10)22-27)28-23-37(11,12)41(16-18-43)38(13,14)24-28/h19-20,27-28,42-43,46H,15-18,21-25H2,1-14H3,(H,44,45) |
| InChIKey | FABSBLCEEBNFAZ-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 104.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.98 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |