C43H74N2O5 — CID 146322192
(1,2,2,6,6-pentamethylpiperidin-4-yl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-formyl-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxymethyl]heptanoate (PubChem CID 146322192) has the molecular formula C43H74N2O5 and a molecular weight of 699.07 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-formyl-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxymethyl]heptanoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-formyl-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxymethyl]heptanoate |
|---|---|
| PubChem CID | 146322192 |
| Molecular Formula | C43H74N2O5 |
| Molecular Weight | 699.07 g/mol |
| Exact Mass | 698.56 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 3-(3,5-ditert-butyl-4-hydroxyphenyl)-2-formyl-2-[(1,2,2,6,6-pentamethylpiperidin-4-yl)oxymethyl]heptanoate |
| SMILES | CCCCC(c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)C(C=O)(COC1CC(C)(C)N(C)C(C)(C)C1)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C43H74N2O5/c1-18-19-20-32(29-21-33(37(2,3)4)35(47)34(22-29)38(5,6)7)43(27-46,28-49-30-23-39(8,9)44(16)40(10,11)24-30)36(48)50-31-25-41(12,13)45(17)42(14,15)26-31/h21-22,27,30-32,47H,18-20,23-26,28H2,1-17H3 |
| InChIKey | IMJJHLKRDUFITF-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.07 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|