C46H80N2O5 — CID 88768078
bis(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) 2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-2-ethylpropanedioate (PubChem CID 88768078) has the molecular formula C46H80N2O5 and a molecular weight of 741.15 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) 2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-2-ethylpropanedioate.
| Compound Name | bis(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) 2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-2-ethylpropanedioate |
|---|---|
| PubChem CID | 88768078 |
| Molecular Formula | C46H80N2O5 |
| Molecular Weight | 741.15 g/mol |
| Exact Mass | 740.61 |
| IUPAC Name | bis(2,2,6,6-tetramethyl-1-propylpiperidin-4-yl) 2-[1-(3,5-ditert-butyl-4-hydroxyphenyl)propyl]-2-ethylpropanedioate |
| SMILES | CCCN1C(C)(C)CC(OC(=O)C(CC)(C(=O)OC2CC(C)(C)N(CCC)C(C)(C)C2)C(CC)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)CC1(C)C |
| InChI | InChI=1S/C46H80N2O5/c1-19-23-47-42(11,12)27-32(28-43(47,13)14)52-38(50)46(22-4,39(51)53-33-29-44(15,16)48(24-20-2)45(17,18)30-33)34(21-3)31-25-35(40(5,6)7)37(49)36(26-31)41(8,9)10/h25-26,32-34,49H,19-24,27-30H2,1-18H3 |
| InChIKey | HKPFSBOKYXVFAF-UHFFFAOYSA-N |
| XLogP | 10.83 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.15 |
| LogP ≤ 5 | 10.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|