C36H62N2O5 — CID 59882771
(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[hydroperoxy-(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]hexanoate (PubChem CID 59882771) has the molecular formula C36H62N2O5 and a molecular weight of 602.90 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[hydroperoxy-(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]hexanoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[hydroperoxy-(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]hexanoate |
|---|---|
| PubChem CID | 59882771 |
| Molecular Formula | C36H62N2O5 |
| Molecular Weight | 602.90 g/mol |
| Exact Mass | 602.47 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-[hydroperoxy-(1,2,2,6,6-pentamethylpiperidin-4-yl)methyl]-2-[(4-hydroxy-3,5-dimethylphenyl)methyl]hexanoate |
| SMILES | CCCCC(Cc1cc(C)c(O)c(C)c1)(C(=O)OC1CC(C)(C)N(C)C(C)(C)C1)C(OO)C1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C36H62N2O5/c1-14-15-16-36(19-26-17-24(2)29(39)25(3)18-26,30(43-41)27-20-32(4,5)37(12)33(6,7)21-27)31(40)42-28-22-34(8,9)38(13)35(10,11)23-28/h17-18,27-28,30,39,41H,14-16,19-23H2,1-13H3 |
| InChIKey | IOWALLIXDDNBQJ-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 82.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.90 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|