C19H35NO3 — CID 122576180
(1,2,2,6,6-pentamethylpiperidin-4-yl) 2-oxononanoate (PubChem CID 122576180) has the molecular formula C19H35NO3 and a molecular weight of 325.49 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-oxononanoate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-oxononanoate |
|---|---|
| PubChem CID | 122576180 |
| Molecular Formula | C19H35NO3 |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) 2-oxononanoate |
| SMILES | CCCCCCCC(=O)C(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C19H35NO3/c1-7-8-9-10-11-12-16(21)17(22)23-15-13-18(2,3)20(6)19(4,5)14-15/h15H,7-14H2,1-6H3 |
| InChIKey | DCIMCDIGOAUEKH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|