C22H43NO — CID 134316434
1,2,2,6,6-pentamethyl-4-(3-methylundec-1-en-2-yloxy)piperidine (PubChem CID 134316434) has the molecular formula C22H43NO and a molecular weight of 337.59 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethyl-4-(3-methylundec-1-en-2-yloxy)piperidine.
| Compound Name | 1,2,2,6,6-pentamethyl-4-(3-methylundec-1-en-2-yloxy)piperidine |
|---|---|
| PubChem CID | 134316434 |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | 1,2,2,6,6-pentamethyl-4-(3-methylundec-1-en-2-yloxy)piperidine |
| SMILES | C=C(OC1CC(C)(C)N(C)C(C)(C)C1)C(C)CCCCCCCC |
| InChI | InChI=1S/C22H43NO/c1-9-10-11-12-13-14-15-18(2)19(3)24-20-16-21(4,5)23(8)22(6,7)17-20/h18,20H,3,9-17H2,1-2,4-8H3 |
| InChIKey | DJKZKJQWRGIMLG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|