C26H54N4 — CID 141204239
1-N,1-N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexane-1,1-diamine (PubChem CID 141204239) has the molecular formula C26H54N4 and a molecular weight of 422.75 g/mol. Its IUPAC name is 1-N,1-N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexane-1,1-diamine |
|---|---|
| PubChem CID | 141204239 |
| Molecular Formula | C26H54N4 |
| Molecular Weight | 422.75 g/mol |
| Exact Mass | 422.43 |
| IUPAC Name | 1-N,1-N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)hexane-1,1-diamine |
| SMILES | CCCCCC(NC1CC(C)(C)N(C)C(C)(C)C1)NC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C26H54N4/c1-12-13-14-15-22(27-20-16-23(2,3)29(10)24(4,5)17-20)28-21-18-25(6,7)30(11)26(8,9)19-21/h20-22,27-28H,12-19H2,1-11H3 |
| InChIKey | KKJSZWXUUGJUSE-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|