C17H41N5 — CID 159126034
N'-(aminomethyl)ethane-1,2-diamine;N-butyl-1,2,2,6,6-pentamethylpiperidin-4-amine (PubChem CID 159126034) has the molecular formula C17H41N5 and a molecular weight of 315.55 g/mol. Its IUPAC name is N'-(aminomethyl)ethane-1,2-diamine;N-butyl-1,2,2,6,6-pentamethylpiperidin-4-amine.
| Compound Name | N'-(aminomethyl)ethane-1,2-diamine;N-butyl-1,2,2,6,6-pentamethylpiperidin-4-amine |
|---|---|
| PubChem CID | 159126034 |
| Molecular Formula | C17H41N5 |
| Molecular Weight | 315.55 g/mol |
| Exact Mass | 315.34 |
| IUPAC Name | N'-(aminomethyl)ethane-1,2-diamine;N-butyl-1,2,2,6,6-pentamethylpiperidin-4-amine |
| SMILES | CCCCNC1CC(C)(C)N(C)C(C)(C)C1.NCCNCN |
| InChI | InChI=1S/C14H30N2.C3H11N3/c1-7-8-9-15-12-10-13(2,3)16(6)14(4,5)11-12;4-1-2-6-3-5/h12,15H,7-11H2,1-6H3;6H,1-5H2 |
| InChIKey | KGHANDCUROPTHP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.55 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|