C19H38N2O2 — CID 174411658
1-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]oxycyclohexan-1-ol (PubChem CID 174411658) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is 1-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]oxycyclohexan-1-ol.
| Compound Name | 1-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]oxycyclohexan-1-ol |
|---|---|
| PubChem CID | 174411658 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | 1-[4-(butylamino)-2,2,6,6-tetramethylpiperidin-1-yl]oxycyclohexan-1-ol |
| SMILES | CCCCNC1CC(C)(C)N(OC2(O)CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C19H38N2O2/c1-6-7-13-20-16-14-17(2,3)21(18(4,5)15-16)23-19(22)11-9-8-10-12-19/h16,20,22H,6-15H2,1-5H3 |
| InChIKey | UCEABMNNXFAGEQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|