C37H71N3O2 — CID 157057576
1-cyclohexyloxy-N-[7-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)heptyl]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 157057576) has the molecular formula C37H71N3O2 and a molecular weight of 589.99 g/mol. Its IUPAC name is 1-cyclohexyloxy-N-[7-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)heptyl]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | 1-cyclohexyloxy-N-[7-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)heptyl]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 157057576 |
| Molecular Formula | C37H71N3O2 |
| Molecular Weight | 589.99 g/mol |
| Exact Mass | 589.55 |
| IUPAC Name | 1-cyclohexyloxy-N-[7-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)heptyl]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CC1(C)CC(CCCCCCCNC2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)CC(C)(C)N1OC1CCCCC1 |
| InChI | InChI=1S/C37H71N3O2/c1-34(2)26-30(27-35(3,4)39(34)41-32-21-15-12-16-22-32)20-14-10-9-11-19-25-38-31-28-36(5,6)40(37(7,8)29-31)42-33-23-17-13-18-24-33/h30-33,38H,9-29H2,1-8H3 |
| InChIKey | YYUPIRLELBIQDU-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.99 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|