C48H92N6O4 — CID 54505780
2,2-bis[4-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butylamino]decanediamide (PubChem CID 54505780) has the molecular formula C48H92N6O4 and a molecular weight of 817.30 g/mol. Its IUPAC name is 2,2-bis[4-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butylamino]decanediamide.
| Compound Name | 2,2-bis[4-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butylamino]decanediamide |
|---|---|
| PubChem CID | 54505780 |
| Molecular Formula | C48H92N6O4 |
| Molecular Weight | 817.30 g/mol |
| Exact Mass | 816.72 |
| IUPAC Name | 2,2-bis[4-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)butylamino]decanediamide |
| SMILES | CC1(C)CC(CCCCNC(CCCCCCCC(N)=O)(NCCCCC2CC(C)(C)N(OC3CCCCC3)C(C)(C)C2)C(N)=O)CC(C)(C)N1OC1CCCCC1 |
| InChI | InChI=1S/C48H92N6O4/c1-44(2)34-38(35-45(3,4)53(44)57-40-26-14-12-15-27-40)24-19-22-32-51-48(43(50)56,31-21-11-9-10-18-30-42(49)55)52-33-23-20-25-39-36-46(5,6)54(47(7,8)37-39)58-41-28-16-13-17-29-41/h38-41,51-52H,9-37H2,1-8H3,(H2,49,55)(H2,50,56) |
| InChIKey | YFPDNNBSDQVHIV-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.30 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|