C42H72N8O4 — CID 19831371
4-cyano-4-[[2-cyano-5-[(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-5-oxopentan-2-yl]diazenyl]-N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)pentanamide (PubChem CID 19831371) has the molecular formula C42H72N8O4 and a molecular weight of 753.09 g/mol. Its IUPAC name is 4-cyano-4-[[2-cyano-5-[(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-5-oxopentan-2-yl]diazenyl]-N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)pentanamide.
| Compound Name | 4-cyano-4-[[2-cyano-5-[(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-5-oxopentan-2-yl]diazenyl]-N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)pentanamide |
|---|---|
| PubChem CID | 19831371 |
| Molecular Formula | C42H72N8O4 |
| Molecular Weight | 753.09 g/mol |
| Exact Mass | 752.57 |
| IUPAC Name | 4-cyano-4-[[2-cyano-5-[(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)amino]-5-oxopentan-2-yl]diazenyl]-N-(1-cyclohexyloxy-2,2,6,6-tetramethylpiperidin-4-yl)pentanamide |
| SMILES | CC(C#N)(CCC(=O)NC1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1)/N=N/C(C)(C#N)CCC(=O)NC1CC(C)(C)N(OC2CCCCC2)C(C)(C)C1 |
| InChI | InChI=1S/C42H72N8O4/c1-37(2)25-31(26-38(3,4)49(37)53-33-17-13-11-14-18-33)45-35(51)21-23-41(9,29-43)47-48-42(10,30-44)24-22-36(52)46-32-27-39(5,6)50(40(7,8)28-32)54-34-19-15-12-16-20-34/h31-34H,11-28H2,1-10H3,(H,45,51)(H,46,52)/b48-47+ |
| InChIKey | FWKJFFUUMUOGPT-QJGAVIKSSA-N |
| XLogP | 8.37 |
| TPSA | 155.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.09 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|