C13H23N2O3 — CID 102300750
CID 102300750 (PubChem CID 102300750) has the molecular formula C13H23N2O3 and a molecular weight of 255.34 g/mol.
| Compound Name | CID 102300750 |
|---|---|
| PubChem CID | 102300750 |
| Molecular Formula | C13H23N2O3 |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | — |
| SMILES | CC1(C)CC(NC(=O)CCC=O)CC(C)(C)N1[O] |
| InChI | InChI=1S/C13H23N2O3/c1-12(2)8-10(9-13(3,4)15(12)18)14-11(17)6-5-7-16/h7,10H,5-6,8-9H2,1-4H3,(H,14,17) |
| InChIKey | ZLHGGQQUQCOQJH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|